Name | myristic acid sodium salt |
Synonyms | Natriummyristat SODIUMMYRISTOATE Einecs 212-487-9 myristic acid sodium myristic acid sodium salt Myristic acid sodium salt, Tetradecanoic acid sodium salt Sodium myristate,Myristic acid sodium salt, Tetradecanoic acid sodium salt |
CAS | 822-12-8 |
EINECS | 212-487-9 |
InChI | InChI=1/C14H28O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;/h2-13H2,1H3,(H,15,16);/q;+1/p-1 |
InChIKey | JUQGWKYSEXPRGL-UHFFFAOYSA-M |
Molecular Formula | C14H27NaO2 |
Molar Mass | 250.35 |
Melting Point | 330 °C |
Boling Point | 319.6°C at 760 mmHg |
Flash Point | 144.8°C |
Solubility | almost transparency in hot EtOH50vol% |
Vapor Presure | 0.000139mmHg at 25°C |
Appearance | powder to crystal |
Color | White to Almost white |
BRN | 3575157 |
Storage Condition | 2-8°C |
MDL | MFCD00042653 |
WGK Germany | 1 |
RTECS | QH4455000 |
EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |